LBF18306HO01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 7: | Line 7: | ||
|Common Name=&&alpha-Kamlolenic acid&& | |Common Name=&&alpha-Kamlolenic acid&& | ||
|Melting Point=77-78°C | |Melting Point=77-78°C | ||
|Solubility= | |Solubility=// | ||
}} | }} | ||
Revision as of 09:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0381 |
| LipidMaps | LMFA01050115 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18306HO01 |
| α-Kamlolenic acid | |
|---|---|
| |
| Structural Information | |
| 18-Hydroxy-cis-9,trans-11,trans-13-octadecatrienoic acid | |
| |
| Formula | C18H30O3 |
| Exact Mass | 294.21949482599996 |
| Average Mass | 294.429 |
| SMILES | OCCCCC=CC=CC=CCCCCCCCC(O)=O |
| Physicochemical Information | |
| 77-78°C | |
| // | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
