LBF18306SC01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 7: | Line 7: | ||
|Common Name=&&Calea&& | |Common Name=&&Calea&& | ||
|Melting Point=61-61.5°C | |Melting Point=61-61.5°C | ||
|Solubility=soluble in acetone, ethanol, ether, and petroleumether. | |Solubility=soluble in acetone, ethanol, ether, and petroleumether. | ||
}} | }} | ||
Revision as of 09:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0179 |
| LipidMaps | LMFA01030140 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18306SC01 |
| Calea | |
|---|---|
| |
| Structural Information | |
| trans-3, cis-9, cis-12-Octadecatrienoic acid | |
| |
| Formula | C18H30O2 |
| Exact Mass | 278.224580204 |
| Average Mass | 278.4296 |
| SMILES | CCCCCC=CCC=CCCCCC=CCC(O)=O |
| Physicochemical Information | |
| 61-61.5°C | |
| soluble in acetone, ethanol, ether, and petroleumether. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
