LBF18306SC05: Difference between revisions
No edit summary |
No edit summary |
||
| Line 7: | Line 7: | ||
|Common Name=&&beta-Calendic acid&& | |Common Name=&&beta-Calendic acid&& | ||
|Melting Point=77-78°C | |Melting Point=77-78°C | ||
|Solubility=soluble in ethanol, CS<SUB><FONT SIZE=-1>2</FONT></SUB>, ether, heptane, metylalcohol and petroleum ether. | |Solubility=soluble in ethanol, CS<SUB><FONT SIZE=-1>2</FONT></SUB>, ether, heptane, metylalcohol and petroleum ether.[[Reference:Kass_JP:Nichols_J:Burr_GO:,J. Am. Chem. Soc.,1941,63,1060|{{RelationTable/GetFirstAuthor|Reference:Kass_JP:Nichols_J:Burr_GO:,J. Am. Chem. Soc.,1941,63,1060}}]] | ||
}} | }} | ||
Revision as of 00:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0184 |
| LipidMaps | LMFA01030145 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18306SC05 |
| β-Calendic acid | |
|---|---|
| |
| Structural Information | |
| trans-8, trans-10, trans-12-Octadecatrienoic acid | |
| |
| Formula | C18H30O2 |
| Exact Mass | 278.224580204 |
| Average Mass | 278.4296 |
| SMILES | CCCCCC=CC=CC=CCCCCCCC(O)=O |
| Physicochemical Information | |
| 77-78°C | |
| soluble in ethanol, CS2, ether, heptane, metylalcohol and petroleum ether. Kass_JP et al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
