LBF18307HP01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01040034 | |LipidMaps=LMFA01040034 | ||
|SysName=13S-hydroperoxy-6Z,9Z,11E-octadecatrienoic acid | |SysName=13S-hydroperoxy-6Z,9Z,11E-octadecatrienoic acid | ||
|Common Name=&&13S-hydroperoxy-6Z,9Z,11E-octadecatrienoic acid&& | |||
|UV Spectra=<FONT FACE="Symbol">l</FONT>max: 235nm <FONT FACE="Symbol">e</FONT>: 23,000 | |UV Spectra=<FONT FACE="Symbol">l</FONT>max: 235nm <FONT FACE="Symbol">e</FONT>: 23,000 | ||
}} | }} | ||
Revision as of 09:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA8151 |
| LipidMaps | LMFA01040034 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18307HP01 |
| 13S-hydroperoxy-6Z,9Z,11E-octadecatrienoic acid | |
|---|---|
| |
| Structural Information | |
| 13S-hydroperoxy-6Z,9Z,11E-octadecatrienoic acid | |
| |
| Formula | C18H30O4 |
| Exact Mass | 310.21440944799997 |
| Average Mass | 310.4284 |
| SMILES | CCCCCC(OO)C=CC=CCC=CCCCCC(O)=O |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | lmax: 235nm e: 23,000 |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
