LBF20107PG13: Difference between revisions
m LBF20207PG16 moved to LBF20107PG13 |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA03010069 | |LipidMaps=LMFA03010069 | ||
|SysName= 9beta,11alpha,15S-trihydroxy-prost-13E-en-1-oic acid | |SysName= 9beta,11alpha,15S-trihydroxy-prost-13E-en-1-oic acid | ||
|Common Name=&&Prostaglandin | |Common Name=&&Prostaglandin F_1beta&& | ||
}} | }} | ||
Revision as of 16:03, 19 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR1751 |
| LipidMaps | LMFA03010069 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20107PG13 |
| Prostaglandin F_1β | |
|---|---|
| |
| Structural Information | |
| 9β,11α,15S-trihydroxy-prost-13E-en-1-oic acid | |
| |
| Formula | C20H36O5 |
| Exact Mass | 356.256274262 |
| Average Mass | 356.49684 |
| SMILES | C(CC[C@@H](O)C=C[C@H]([C@H]1CCCCCCC(O)=O)[C@@H](C[C@H]1O)O)CC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
