LBF20107PG14: Difference between revisions
No edit summary |
m LBF20207PG17 moved to LBF20107PG14 |
||
(No difference)
| |||
Revision as of 17:43, 16 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR1752 |
| LipidMaps | LMFA03010070 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20107PG14 |
| 11-deoxy Prostaglandin F1β | |
|---|---|
| |
| Structural Information | |
| 9β,15S-dihydroxy-prost-13E-en-1-oic acid | |
| |
| Formula | C20H36O4 |
| Exact Mass | 340.26135963999997 |
| Average Mass | 340.49744 |
| SMILES | C(CC[C@@H](O)C=C[C@H]([C@H]1CCCCCCC(O)=O)CC[C@@H](O)1)CC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
