LBF20107PG19: Difference between revisions
No edit summary |
m LBF20307PG27 moved to LBF20107PG19 |
(No difference)
| |
Revision as of 17:55, 16 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR1777 |
| LipidMaps | - |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20107PG19 |
| 8-iso Prostaglandin E1 | |
|---|---|
| |
| Structural Information | |
| 9-oxo-11a,15S-dihydroxy- (8b) -prost-13E-en-1-oic acid | |
| |
| Formula | C20H34O5 |
| Exact Mass | 354.240624198 |
| Average Mass | 354.48096000000004 |
| SMILES | C(CC[C@H](O)C=C[C@H]([C@@H]1CCCCCCC(O)=O)[C@@H](CC1=O)O)CC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
