LBF20207PG44: Difference between revisions
No edit summary |
m LBF20307PG30 moved to LBF20207PG44 |
||
(No difference)
| |||
Revision as of 17:56, 16 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR1783 |
| LipidMaps | LMFA03010113 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20207PG44 |
| Prostaglandin F2a Alcohol | |
|---|---|
| |
| Structural Information | |
| 1,9a,11a,15S-tetrahydroxyprosta-5Z,13E-dien | |
| |
| Formula | C20H36O4 |
| Exact Mass | 340.26135963999997 |
| Average Mass | 340.49744 |
| SMILES | C(CC[C@H](O)C=C[C@H]([C@H]1CC=CCCCCO)[C@@H](C[C@@H]1O)O)CC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
