LBF20207PG49: Difference between revisions
No edit summary |
m LBF20307PG35 moved to LBF20207PG49 |
(No difference)
| |
Revision as of 17:57, 16 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR1798 |
| LipidMaps | LMFA03010010 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20207PG49 |
| Prostaglandin H2 | |
|---|---|
| |
| Structural Information | |
| 9a,11a-epidioxy-15S-hydroxy-prosta-5Z,13E-dien-1-oic acid | |
| |
| Formula | C20H32O5 |
| Exact Mass | 352.224974134 |
| Average Mass | 352.46508 |
| SMILES | C(CC[C@H](O)C=C[C@@H]([C@H]21)[C@@H](CC=CCCCC(O)=O)[C@@H](OO2)C1)CC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
