LBF20303PG05: Difference between revisions
m LBF20403PG05 moved to LBF20303PG05 |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA03010142 | |LipidMaps=LMFA03010142 | ||
|SysName=9alpha,15S-dihydroxy-11-oxo-prosta-5Z,13E,17Z-trien-1-oic acid | |SysName=9alpha,15S-dihydroxy-11-oxo-prosta-5Z,13E,17Z-trien-1-oic acid | ||
|Common Name=&&Prostaglandin | |Common Name=&&Prostaglandin D_3&& | ||
}} | }} | ||
Revision as of 16:42, 19 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR1705 |
| LipidMaps | LMFA03010142 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20303PG05 |
| Prostaglandin D3 | |
|---|---|
| |
| Structural Information | |
| 9α,15S-dihydroxy-11-oxo-prosta-5Z,13E,17Z-trien-1-oic acid | |
| |
| Formula | C20H30O5 |
| Exact Mass | 350.20932407 |
| Average Mass | 350.4492 |
| SMILES | C(=CC[C@@H](O)C=C[C@H]([C@H]1CC=CCCCC(O)=O)C(C[C@@H]1O)=O)CC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | |||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
