LBF20309SC01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01030157 | |LipidMaps=LMFA01030157 | ||
|SysName=5, 8, 11-Eicosatrienoic acid / 5, 8, 11-icosatrienoic acid | |SysName=5, 8, 11-Eicosatrienoic acid / 5, 8, 11-icosatrienoic acid | ||
|Solubility=solubule in CS<SUB><FONT SIZE=-1>2</FONT></SUB>, heptane and methylalcohol. | |Solubility=solubule in CS<SUB><FONT SIZE=-1>2</FONT></SUB>, heptane and methylalcohol.[[Reference:Klenk_E:Bongard_W:,Hoppe Seylers Z. Physiol. Chem.,1952,291,104|{{RelationTable/GetFirstAuthor|Reference:Klenk_E:Bongard_W:,Hoppe Seylers Z. Physiol. Chem.,1952,291,104}}]] | ||
}} | }} | ||
Revision as of 09:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0196 |
| LipidMaps | LMFA01030157 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20309SC01 |
| GlcNAca/b1-3Xyla-4Galb1-3GalNAca1-4(NeuAc?1-2NeuGc4Mea1-3)GalNAcb1-4(EtnP-6)GlcNAcb1-3Manb1-4Glcb1-1Cer | |
|---|---|
| |
| Structural Information | |
| 5, 8, 11-Eicosatrienoic acid / 5, 8, 11-icosatrienoic acid | |
| Formula | C20H34O2 |
| Exact Mass | 306.255880332 |
| Average Mass | 306.48276000000004 |
| SMILES | C(CCCCC=CCC=CCC=CCCCC(O)=O)CCC |
| Physicochemical Information | |
| solubule in CS2, heptane and methylalcohol. KlenkEet al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
