LBF20406AM10: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA08020012 | |LipidMaps=LMFA08020012 | ||
|SysName=N-tert-butyl arachidonoyl amide | |SysName=N-tert-butyl arachidonoyl amide | ||
|Common Name=&&N-tert-butyl arachidonoyl amide&& | |||
|Melting Point=colorless oil [[Reference:Sheskin_T:Hanus_L:Slager_J:Vogel_Z:Mechoulam_R:,J. Med. Chem.,1997,40,659|{{RelationTable/GetFirstAuthor|Reference:Sheskin_T:Hanus_L:Slager_J:Vogel_Z:Mechoulam_R:,J. Med. Chem.,1997,40,659}}]] | |Melting Point=colorless oil [[Reference:Sheskin_T:Hanus_L:Slager_J:Vogel_Z:Mechoulam_R:,J. Med. Chem.,1997,40,659|{{RelationTable/GetFirstAuthor|Reference:Sheskin_T:Hanus_L:Slager_J:Vogel_Z:Mechoulam_R:,J. Med. Chem.,1997,40,659}}]] | ||
|NMR Spectra=<SUP><FONT SIZE=-1>1</FONT></SUP>H NMR (CCCl3) <FONT FACE="Symbol">d</FONT>5.30-5.40 (m, | |NMR Spectra=<SUP><FONT SIZE=-1>1</FONT></SUP>H NMR (CCCl3) <FONT FACE="Symbol">d</FONT>5.30-5.40 (m, | ||
}} | }} | ||
Revision as of 09:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR7026 |
| LipidMaps | LMFA08020012 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20406AM10 |
| N-tert-butyl arachidonoyl amide | |
|---|---|
| |
| Structural Information | |
| N-tert-butyl arachidonoyl amide | |
| |
| Formula | C24H41NO |
| Exact Mass | 359.318814939 |
| Average Mass | 359.58847999999995 |
| SMILES | C(=CCCCC(NC(C)(C)C)=O)CC=CCC=CCC=CCCCCC |
| Physicochemical Information | |
| colorless oil Sheskin_T et al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CCCl3) d5.30-5.40 (m, |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
