LBF20406AM41: Difference between revisions
No edit summary |
m LBF20506AM01 moved to LBF20406AM41 |
(No difference)
| |
Revision as of 18:02, 16 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR7066 |
| LipidMaps | LMFA08020052 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20406AM41 |
| GlcNAca/b1-3Xyla-4Galb1-3GalNAca1-4(NeuAc?1-2NeuGc4Mea1-3)GalNAcb1-4(EtnP-6)GlcNAcb1-3Manb1-4Glcb1-1Cer | |
|---|---|
| |
| Structural Information | |
| arachidonoylmorpholine | |
| Formula | C24H39NO2 |
| Exact Mass | 373.298079497 |
| Average Mass | 373.572 |
| SMILES | O=C(N(C1)CCOC1)CCCC=CCC=CCC=CCC=CCCCCC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
