LBF20406AM43: Difference between revisions
m LBF20806AM02 moved to LBF20406AM43 |
m LBF20806AM02 moved to LBF20406AM43 |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA08020054 | |LipidMaps=LMFA08020054 | ||
|SysName=arachidonoyl- (2'-phenoxyethyl) amide | |SysName=arachidonoyl- (2'-phenoxyethyl) amide | ||
|Common Name=&&arachidonoyl- (2'-phenoxyethyl) amide&& | |||
}} | }} | ||
Revision as of 09:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR7068 |
| LipidMaps | LMFA08020054 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20406AM43 |
| arachidonoyl- (2'-phenoxyethyl) amide | |
|---|---|
| |
| Structural Information | |
| arachidonoyl- (2'-phenoxyethyl) amide | |
| |
| Formula | C28H41NO2 |
| Exact Mass | 423.313729561 |
| Average Mass | 423.63068 |
| SMILES | C(=CCCCC(NCCOc(c1)cccc1)=O)CC=CCC=CCC=CCCCCC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
