LBF20406SC01: Difference between revisions
No edit summary |
No edit summary |
||
(No difference)
| |||
Revision as of 09:03, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0213 |
| LipidMaps | LMFA01030001 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20406SC01 |
| Arachidonic acid | |
|---|---|
| |
| Structural Information | |
| 5, 8, 11, 14-Eicosatetraenoic acid / 5, 8, 11, 14-icosatetraenoic acid | |
| |
| Formula | C20H32O2 |
| Exact Mass | 304.240230268 |
| Average Mass | 304.46688 |
| SMILES | C(CC=CCC=CCC=CCC=CCCCC(O)=O)CCC |
| Physicochemical Information | |
| -49.5 °C | |
| 163 °C at 1 mmHg | |
| 0.9082 at 20 °C | |
| 1.4824 at 20 °C | |
| soluble in acetone, methyl alcohol, ether and petroleum ether. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
