LBF22209PG13: Difference between revisions
No edit summary |
m LBF22309PG01 moved to LBF22209PG13 |
||
(No difference)
| |||
Revision as of 18:12, 16 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR1791 |
| LipidMaps | LMFA03010120 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF22209PG13 |
| 20-ethyl Prostaglandin F2a | |
|---|---|
| |
| Structural Information | |
| 9a,11a-15S-trihydroxy-20a,20b-dihomoprosta-5Z,13E-dien-1-oic acid | |
| |
| Formula | C22H38O5 |
| Exact Mass | 382.271924326 |
| Average Mass | 382.53412000000003 |
| SMILES | C(CC[C@@H](C=C[C@H]([C@H]1CC=CCCCC(O)=O)[C@@H](C[C@H](O)1)O)O)CCCC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
