LBF22403SC01: Difference between revisions
No edit summary |
No edit summary |
(No difference)
| |
Revision as of 09:02, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0218 |
| LipidMaps | LMFA01030179 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF22403SC01 |
| Stearidonic acid | |
|---|---|
| |
| Structural Information | |
| 8, 12, 16, 19 (20) -Docosatetraenoic acid | |
| |
| Formula | C22H36O2 |
| Exact Mass | 332.271530396 |
| Average Mass | 332.52004000000005 |
| SMILES | C(CCC(O)=O)CCCC=CCCC=CCCC=CCC=CCC |
| Physicochemical Information | |
| soluble in acetone, methyl alcohol and petroleum ether. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
