LBF22506SC01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01030182 | |LipidMaps=LMFA01030182 | ||
|SysName=4, 7, 10, 13, 16-Docosapentaenoic acid | |SysName=4, 7, 10, 13, 16-Docosapentaenoic acid | ||
|Solubility=soluble in chloroform, heptane and methyi alcohol. | |Solubility=soluble in chloroform, heptane and methyi alcohol. | ||
}} | }} | ||
Revision as of 09:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0221 |
| LipidMaps | LMFA01030182 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF22506SC01 |
| GlcNAca/b1-3Xyla-4Galb1-3GalNAca1-4(NeuAc?1-2NeuGc4Mea1-3)GalNAcb1-4(EtnP-6)GlcNAcb1-3Manb1-4Glcb1-1Cer | |
|---|---|
| |
| Structural Information | |
| 4, 7, 10, 13, 16-Docosapentaenoic acid | |
| Formula | C22H34O2 |
| Exact Mass | 330.255880332 |
| Average Mass | 330.50416000000007 |
| SMILES | C(CCC(O)=O)=CCC=CCC=CCC=CCC=CCCCCC |
| Physicochemical Information | |
| soluble in chloroform, heptane and methyi alcohol. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
