LBF232nnPG01: Difference between revisions
m LBF237nnPG01 moved to LBF232nnPG01 |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA03010067 | |LipidMaps=LMFA03010067 | ||
|SysName= 9-oxo-11alpha,15S-dihydroxy-17-phenyl-18,19,20-trinor-prosta-5Z13E-dien-1-oic acid | |SysName= 9-oxo-11alpha,15S-dihydroxy-17-phenyl-18,19,20-trinor-prosta-5Z13E-dien-1-oic acid | ||
|Common Name=&&17-phenyl trinor Prostaglandin | |Common Name=&&17-phenyl trinor Prostaglandin E_2&& | ||
}} | }} | ||
Revision as of 16:55, 19 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR1749 |
| LipidMaps | LMFA03010067 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF232nnPG01 |
| 17-phenyl trinor Prostaglandin E2 | |
|---|---|
| |
| Structural Information | |
| 9-oxo-11α,15S-dihydroxy-17-phenyl-18,19,20-trinor-prosta-5Z13E-dien-1-oic acid | |
| |
| Formula | C23H30O5 |
| Exact Mass | 386.20932407 |
| Average Mass | 386.48130000000003 |
| SMILES | C(c(c2)cccc2)C[C@H](C=C[C@H]([C@H]1CC=CCCCC(O)=O)[C@@H](CC(=O)1)O)O |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
