LBG00-kk::16114BC01:16114BC01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 2: | Line 2: | ||
|LipidBank=EEL0218 | |LipidBank=EEL0218 | ||
|SysName=2,3-di-O-phytyl-sn-glycerol | |SysName=2,3-di-O-phytyl-sn-glycerol | ||
|Common Name=&& | |Common Name=&&2,3-di-O- (3',7',11',15'-tetramethyl-2'-hexadecyl) -sn-glycerol&&2,3-di-O-phytyl-sn-glycerol&& | ||
}} | }} | ||
Revision as of 20:00, 8 July 2009
| IDs and Links | |
|---|---|
| LipidBank | EEL0218 |
| LipidMaps | [1] |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBG00-kk::16114BC01:16114BC01 |
| 2,3-di-O- (3',7',11',15'-tetramethyl-2'-hexadecyl) -sn-glycerol | |
|---|---|
| |
| Structural Information | |
| 2,3-di-O-phytyl-sn-glycerol | |
| |
| Formula | C44H88O3 |
| Exact Mass | 664.673346682 |
| Average Mass | 665.16772 |
| SMILES | C([H])(CO)(OCC=C(C)CCCC(CCCC(C)CCCC(C)C)C)COCC=C(CCCC(C)CCCC(C)CCC)C |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
