LBF10105BC01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01020142 | |LipidMaps=LMFA01020142 | ||
|SysName=6-Isopentyl-9-Methyl-5-Decenoic Acid | |SysName=6-Isopentyl-9-Methyl-5-Decenoic Acid | ||
|Boiling Point=142 - 145°C/0.2mmHg | |Boiling Point=142 - 145°C/0.2mmHg [[Reference:Asano_M:Yamakawa_T:,J. Pharm. Soc. Jpn.,1950,70,474|{{RelationTable/GetFirstAuthor|Reference:Asano_M:Yamakawa_T:,J. Pharm. Soc. Jpn.,1950,70,474}}]] | ||
|Optical=<FONT FACE="Symbol">h</FONT>20/D = 1.4562 | |Optical=<FONT FACE="Symbol">h</FONT>20/D = 1.4562 [[Reference:Asano_M:Yamakawa_T:,J. Pharm. Soc. Jpn.,1950,70,474|{{RelationTable/GetFirstAuthor|Reference:Asano_M:Yamakawa_T:,J. Pharm. Soc. Jpn.,1950,70,474}}]] | ||
}} | }} | ||
Revision as of 09:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA7110 |
| LipidMaps | LMFA01020142 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF10105BC01 |
| GlcNAca/b1-3Xyla-4Galb1-3GalNAca1-4(NeuAc?1-2NeuGc4Mea1-3)GalNAcb1-4(EtnP-6)GlcNAcb1-3Manb1-4Glcb1-1Cer | |
|---|---|
| |
| Structural Information | |
| 6-Isopentyl-9-Methyl-5-Decenoic Acid | |
| Formula | C16H30O2 |
| Exact Mass | 254.22458020399998 |
| Average Mass | 254.4082 |
| SMILES | CC(C)CCC=C(CCCC(O)=O)CCC(C)C |
| Physicochemical Information | |
| 142 - 145°C/0.2mmHg Asano_M et al. | |
| h20/D = 1.4562 AsanoMet al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
