LBF12103JA01: Difference between revisions
m LBF12203JA01 moved to LBF12103JA01 |
m LBF12203JA01 moved to LBF12103JA01 |
(No difference)
| |
Revision as of 09:03, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA8101 |
| LipidMaps | - |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF12103JA01 |
| Cucurbic acid | |
|---|---|
| |
| Structural Information | |
| 3-Hydroxy-2- (2-pentenyl) -cyclopentane 1-acetic acid | |
| |
| Formula | C12H20O3 |
| Exact Mass | 212.141244506 |
| Average Mass | 212.28539999999998 |
| SMILES | CCC=CCC(C(O)1)C(CC1)CC(O)=O |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
