LBF14000BC10: Difference between revisions
mNo edit summary |
mNo edit summary |
(No difference)
| |
Revision as of 09:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA7139 |
| LipidMaps | LMFA01020171 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF14000BC10 |
| 3,5-Dimethyl Tetradecanoic Acid | |
|---|---|
| |
| Structural Information | |
| 3,5-Dimethyl Tetradecanoic Acid | |
| |
| Formula | C16H32O2 |
| Exact Mass | 256.240230268 |
| Average Mass | 256.42408 |
| SMILES | CCCCCCCCCC(C)CC(C)CC(O)=O |
| Physicochemical Information | |
| 147-149°C/0.5mmHg Petrov_AD et al. | |
| D20/4=0.8859 Petrov_AD et al. | |
| h20/D=1.4491 Petrov_AD et al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
