LBF14000HO03: Difference between revisions
No edit summary |
No edit summary |
(No difference)
| |
Revision as of 09:03, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0347 |
| LipidMaps | LMFA01050081 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF14000HO03 |
| 3,11-dihydroxymyristoic acid | |
|---|---|
| |
| Structural Information | |
| 3,11-Dihydroxytetradecanoic acid | |
| |
| Formula | C14H28O4 |
| Exact Mass | 260.19875938399997 |
| Average Mass | 260.36972 |
| SMILES | CCCC(O)CCCCCCCC(O)CC(O)=O |
| Physicochemical Information | |
| 100-101°C | |
| soluble in chloroform and ethanol Huber_WF Lutton_ES et al. Myers_GS | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
