LBF16000HO06: Difference between revisions
No edit summary |
No edit summary |
||
| Line 7: | Line 7: | ||
|Common Name=&&3,12-dihydroxypalmitic acid&& | |Common Name=&&3,12-dihydroxypalmitic acid&& | ||
|Melting Point=83-84°C | |Melting Point=83-84°C | ||
|Solubility=soluble in methanol and alcohol | |Solubility=soluble in methanol and alcohol | ||
}} | }} | ||
Revision as of 09:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0349 |
| LipidMaps | LMFA01050083 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF16000HO06 |
| 3,12-dihydroxypalmitic acid | |
|---|---|
| |
| Structural Information | |
| 3,12-Dihydroxyhexadecanoic acid | |
| |
| Formula | C16H32O4 |
| Exact Mass | 288.23005951199997 |
| Average Mass | 288.42287999999996 |
| SMILES | CCCCC(O)CCCCCCCCC(O)CC(O)=O |
| Physicochemical Information | |
| 83-84°C | |
| soluble in methanol and alcohol | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
