LBF16000OX05: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01060054 | |LipidMaps=LMFA01060054 | ||
|SysName=7-Oxohexadecanoic acid | |SysName=7-Oxohexadecanoic acid | ||
|Common Name=&&7-Ketopalmitic acid&& | |Common Name=&&7-Ketopalmitic acid&&7-Oxohexadecanoic acid&& | ||
|Melting Point=78°C | |Melting Point=78°C | ||
|Solubility= | |Solubility= | ||
}} | }} | ||
Revision as of 00:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0438 |
| LipidMaps | LMFA01060054 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF16000OX05 |
| 7-Ketopalmitic acid | |
|---|---|
| |
| Structural Information | |
| 7-Oxohexadecanoic acid | |
| |
| Formula | C16H30O3 |
| Exact Mass | 270.21949482599996 |
| Average Mass | 270.4076 |
| SMILES | CCCCCCCCCC(=O)CCCCCC(O)=O |
| Physicochemical Information | |
| 78°C | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
