LBF16000OX09: Difference between revisions
No edit summary |
No edit summary |
||
| Line 7: | Line 7: | ||
|Common Name=&&11-Ketopalmitic acid&& | |Common Name=&&11-Ketopalmitic acid&& | ||
|Melting Point=74-75°C / 91-92°C | |Melting Point=74-75°C / 91-92°C | ||
|Solubility= | |Solubility=[[Reference:Davies_LA:Adams_R:,J. Am. Chem. Soc.,1928,50,1749|{{RelationTable/GetFirstAuthor|Reference:Davies_LA:Adams_R:,J. Am. Chem. Soc.,1928,50,1749}}]] | ||
}} | }} | ||
Revision as of 00:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0442 |
| LipidMaps | LMFA01060058 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF16000OX09 |
| 11-Ketopalmitic acid | |
|---|---|
| |
| Structural Information | |
| 11-Oxohexadecanoic acid | |
| |
| Formula | C16H30O3 |
| Exact Mass | 270.21949482599996 |
| Average Mass | 270.4076 |
| SMILES | CCCCCC(=O)CCCCCCCCCC(O)=O |
| Physicochemical Information | |
| 74-75°C / 91-92°C | |
| Davies_LA et al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
