LBF16114BC01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01020137 | |LipidMaps=LMFA01020137 | ||
|SysName=3,7,11,15-Tetramethyl-2 (Z) -Hexadecenoic Acid | |SysName=3,7,11,15-Tetramethyl-2 (Z) -Hexadecenoic Acid | ||
|Common Name=&&Phytenoic Acid&& | |Common Name=&&Phytenoic Acid&&3,7,11,15-Tetramethyl-2 (Z) -Hexadecenoic Acid&& | ||
|Boiling Point=210 - 220°C/11.5mmHg, 174°C/0.4mmHg | |Boiling Point=210 - 220°C/11.5mmHg, 174°C/0.4mmHg | ||
|Density=D20/4 = 0.893 | |Density=D20/4 = 0.893 | ||
}} | }} | ||
Revision as of 00:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA7105 |
| LipidMaps | LMFA01020137 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF16114BC01 |
| Phytenoic Acid | |
|---|---|
| |
| Structural Information | |
| 3,7,11,15-Tetramethyl-2 (Z) -Hexadecenoic Acid | |
| |
| Formula | C20H38O2 |
| Exact Mass | 310.28718046 |
| Average Mass | 310.51452 |
| SMILES | CC(CCCC(CCCC(CCCC(C)C)C)C)=CC(O)=O |
| Physicochemical Information | |
| 210 - 220°C/11.5mmHg, 174°C/0.4mmHg | |
| D20/4 = 0.893 | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
