LBF17000BC01: Difference between revisions
No edit summary |
No edit summary |
(No difference)
| |
Revision as of 09:03, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0238 |
| LipidMaps | LMFA01020013 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF17000BC01 |
| 10-Methylheptadecanoic acid | |
|---|---|
| |
| Structural Information | |
| 10-Methylheptadecanoic acid | |
| |
| Formula | C18H36O2 |
| Exact Mass | 284.271530396 |
| Average Mass | 284.47724 |
| SMILES | CCCCCCCC(C)CCCCCCCCC(O)=O |
| Physicochemical Information | |
| 33.5°C | |
| soluble in acetone and glacial acetic acid WeitzelGet al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
