LBF17000BC03: Difference between revisions
No edit summary |
No edit summary |
(No difference)
| |
Revision as of 09:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA7015 |
| LipidMaps | LMFA01020047 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF17000BC03 |
| 4,14-Dimethylheptadecanoic Acid | |
|---|---|
| |
| Structural Information | |
| 4,14-Dimethylheptadecanoic Acid | |
| |
| Formula | C19H38O2 |
| Exact Mass | 298.28718046 |
| Average Mass | 298.50382 |
| SMILES | CCCC(C)CCCCCCCCCC(C)CCC(O)=O |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | (provided by Dr. Takeshi Kasama). |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
