LBF18000BC04: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01020049 | |LipidMaps=LMFA01020049 | ||
|SysName=4,14-Dimethyloctadecanoic Acid | |SysName=4,14-Dimethyloctadecanoic Acid | ||
|Common Name=&&4,14-Dimethyloctadecanoic Acid&& | |||
}} | }} | ||
Revision as of 17:22, 18 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA7017 |
| LipidMaps | LMFA01020049 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18000BC04 |
| 4,14-Dimethyloctadecanoic Acid | |
|---|---|
| |
| Structural Information | |
| 4,14-Dimethyloctadecanoic Acid | |
| |
| Formula | C20H40O2 |
| Exact Mass | 312.302830524 |
| Average Mass | 312.53040000000004 |
| SMILES | C(CC(CCCCCCCCCC(CCC(O)=O)C)C)CC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
