LBF18206SC11: Difference between revisions
No edit summary |
No edit summary |
||
| Line 8: | Line 8: | ||
|Density=dX<sub>4</sub><sup>70</sup> 0.8686 | |Density=dX<sub>4</sub><sup>70</sup> 0.8686 | ||
|Optical=1.4656 at 70°C | |Optical=1.4656 at 70°C | ||
|Solubility=soluble in acetone, cyclohexane and ether. | |Solubility=soluble in acetone, cyclohexane and ether. | ||
}} | }} | ||
Revision as of 00:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0165 |
| LipidMaps | LMFA01030126 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18206SC11 |
| GlcNAca/b1-3Xyla-4Galb1-3GalNAca1-4(NeuAc?1-2NeuGc4Mea1-3)GalNAcb1-4(EtnP-6)GlcNAcb1-3Manb1-4Glcb1-1Cer | |
|---|---|
| |
| Structural Information | |
| trans-10, trans-12-Octadecadienoic acid | |
| Formula | C18H32O2 |
| Exact Mass | 280.240230268 |
| Average Mass | 280.44548000000003 |
| SMILES | CCCCCC=CC=CCCCCCCCCC(O)=O |
| Physicochemical Information | |
| 56°C to 57°C | |
| dX470 0.8686 | |
| 1.4656 at 70°C | |
| soluble in acetone, cyclohexane and ether. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
