LBF18207SC01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01030116 | |LipidMaps=LMFA01030116 | ||
|SysName=cis-8, cis-11-Octadecadienoic acid | |SysName=cis-8, cis-11-Octadecadienoic acid | ||
|Common Name=&&cis-8, cis-11-Octadecadienoic acid&& | |||
|Melting Point=-12.5°C to -9.5°C | |Melting Point=-12.5°C to -9.5°C | ||
|Boiling Point=11.8°C to 20°C at 0.0001mmHg | |Boiling Point=11.8°C to 20°C at 0.0001mmHg | ||
Revision as of 09:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0155 |
| LipidMaps | LMFA01030116 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18207SC01 |
| cis-8, cis-11-Octadecadienoic acid | |
|---|---|
| |
| Structural Information | |
| cis-8, cis-11-Octadecadienoic acid | |
| |
| Formula | C18H32O2 |
| Exact Mass | 280.240230268 |
| Average Mass | 280.44548000000003 |
| SMILES | CCCCCCC=CCC=CCCCCCCC(O)=O |
| Physicochemical Information | |
| -12.5°C to -9.5°C | |
| 11.8°C to 20°C at 0.0001mmHg | |
| 1.4663 at 25°C | |
| Fulco_AJ et al. KlenkEet al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
