LBF18207SC04: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01030119 | |LipidMaps=LMFA01030119 | ||
|SysName=trans-9, trans-11-Octadecadienoic acid | |SysName=trans-9, trans-11-Octadecadienoic acid | ||
|Common Name=&&trans-9, trans-11-Octadecadienoic acid&& | |||
|Melting Point=54°C | |Melting Point=54°C | ||
|Density=d<SUP><FONT SIZE=-1>7</FONT></SUP><SUP><FONT SIZE=-1>7</FONT></SUP><SUB><FONT SIZE=-1>4</FONT></SUB> 0.8659 | |Density=d<SUP><FONT SIZE=-1>7</FONT></SUP><SUP><FONT SIZE=-1>7</FONT></SUP><SUB><FONT SIZE=-1>4</FONT></SUB> 0.8659 | ||
Revision as of 09:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0158 |
| LipidMaps | LMFA01030119 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18207SC04 |
| trans-9, trans-11-Octadecadienoic acid | |
|---|---|
| |
| Structural Information | |
| trans-9, trans-11-Octadecadienoic acid | |
| |
| Formula | C18H32O2 |
| Exact Mass | 280.240230268 |
| Average Mass | 280.44548000000003 |
| SMILES | CCCCCCC=CC=CCCCCCCCC(O)=O |
| Physicochemical Information | |
| 54°C | |
| d774 0.8659 | |
| 1.4624 at 77°C | |
| Teeter_HM et al. Nichols_PL_Jr et al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
