LBF18302HP01: Difference between revisions
No edit summary |
No edit summary |
(No difference)
| |
Revision as of 09:02, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA8055 |
| LipidMaps | LMFA01040039 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18302HP01 |
| Methyl-15-Hydroperoxy-9,12,16-Octadecatrienoate | |
|---|---|
| |
| Structural Information | |
| Methyl-15-Hydroperoxy-9,12,16-Octadecatrienoate | |
| |
| Formula | C19H32O4 |
| Exact Mass | 324.23005951199997 |
| Average Mass | 324.45498 |
| SMILES | CC=CC(OO)CC=CCC=CCCCCCCCC(=O)OC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | EI-MS(Me-ester; after reduction and hydrogenation) Chan_HWS : m/e=271[O=CH(CH2)13C(=OH)OCH3]; 242[CH2(CH2)12C(=OH)OCH3]; 239[O=CH(CH2)13C=O]; GC-EI-MS(Me-ester; after reduction and hydroganation) TeraoJet al.: m/e=143[SMTO=CH-CH=CH-CH3] |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
