LBF18304SC01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 7: | Line 7: | ||
|Density=dX<sub>4</sub><sup>20</sup> 0.9221 | |Density=dX<sub>4</sub><sup>20</sup> 0.9221 | ||
|Optical=1.4794 at 20°C | |Optical=1.4794 at 20°C | ||
|Solubility=soluble in ethanol, pentane and petroleum ether. | |Solubility=soluble in ethanol, pentane and petroleum ether. | ||
}} | }} | ||
Revision as of 09:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0181 |
| LipidMaps | LMFA01030142 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18304SC01 |
| GlcNAca/b1-3Xyla-4Galb1-3GalNAca1-4(NeuAc?1-2NeuGc4Mea1-3)GalNAcb1-4(EtnP-6)GlcNAcb1-3Manb1-4Glcb1-1Cer | |
|---|---|
| |
| Structural Information | |
| 6, 10, 14-Octadecatrienoic acid | |
| Formula | C18H30O2 |
| Exact Mass | 278.224580204 |
| Average Mass | 278.4296 |
| SMILES | CCCC=CCCC=CCCC=CCCCCC(O)=O |
| Physicochemical Information | |
| dX420 0.9221 | |
| 1.4794 at 20°C | |
| soluble in ethanol, pentane and petroleum ether. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
