LBF18306SC02: Difference between revisions
No edit summary |
No edit summary |
||
| Line 10: | Line 10: | ||
|Density=dX<sub>4</sub><sup>20</sup> 0.9164 | |Density=dX<sub>4</sub><sup>20</sup> 0.9164 | ||
|Optical=1.4800 at 20°C | |Optical=1.4800 at 20°C | ||
|Solubility=soluble in acetone, ether, methylalcohol and petroleum ether. | |Solubility=soluble in acetone, ether, methylalcohol and petroleum ether. | ||
}} | }} | ||
Revision as of 00:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0180 |
| LipidMaps | LMFA01030141 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18306SC02 |
| γ-Linolenic acid | |
|---|---|
| |
| Structural Information | |
| cis-6, cis-9, cis-12-Octadecatrienoic acid | |
| |
| Formula | C18H30O2 |
| Exact Mass | 278.224580204 |
| Average Mass | 278.4296 |
| SMILES | CCCCCC=CCC=CCC=CCCCCC(O)=O |
| Physicochemical Information | |
| -11.3 to -11°C | |
| 125°C at 0.05mmHg | |
| dX420 0.9164 | |
| 1.4800 at 20°C | |
| soluble in acetone, ether, methylalcohol and petroleum ether. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
