LBF18401SC01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01030172 | |LipidMaps=LMFA01030172 | ||
|SysName=9, 12, 15, 18-Octadecatetraenoic acid | |SysName=9, 12, 15, 18-Octadecatetraenoic acid | ||
|Common Name=&&9, 12, 15, 18-Octadecatetraenoic acid&& | |||
|Solubility=soluble in carbon disulfide and methyl alcohol. | |Solubility=soluble in carbon disulfide and methyl alcohol. | ||
}} | }} | ||
Revision as of 09:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0211 |
| LipidMaps | LMFA01030172 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18401SC01 |
| 9, 12, 15, 18-Octadecatetraenoic acid | |
|---|---|
| |
| Structural Information | |
| 9, 12, 15, 18-Octadecatetraenoic acid | |
| |
| Formula | C18H28O2 |
| Exact Mass | 276.20893014 |
| Average Mass | 276.41372 |
| SMILES | C=CC=CCC=CCC=CCCCCCCCC(O)=O |
| Physicochemical Information | |
| soluble in carbon disulfide and methyl alcohol. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
