LBF18403SC05: Difference between revisions
No edit summary |
No edit summary |
||
| Line 7: | Line 7: | ||
|Common Name=&&beta-Parinaric acid&& | |Common Name=&&beta-Parinaric acid&& | ||
|Melting Point=95 to 96 °C | |Melting Point=95 to 96 °C | ||
|Solubility=soluble in ether and petroleum ether. | |Solubility=soluble in ether and petroleum ether. | ||
}} | }} | ||
Revision as of 00:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0210 |
| LipidMaps | LMFA01030171 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18403SC05 |
| β-Parinaric acid | |
|---|---|
| |
| Structural Information | |
| trans-9, trans-11, trans-13, trans-15-Octadecatetraenoic acid | |
| |
| Formula | C18H28O2 |
| Exact Mass | 276.20893014 |
| Average Mass | 276.41372 |
| SMILES | CCC=CC=CC=CC=CCCCCCCCC(O)=O |
| Physicochemical Information | |
| 95 to 96 °C | |
| soluble in ether and petroleum ether. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
