LBF19206SC01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01030129 | |LipidMaps=LMFA01030129 | ||
|SysName=cis-10, cis-13-Nonadecadienoic acid | |SysName=cis-10, cis-13-Nonadecadienoic acid | ||
|Solubility= | |Solubility=[[Reference:Karrer_P:Koenig_H:,Helv. Chim. Acta,1943,26,619|{{RelationTable/GetFirstAuthor|Reference:Karrer_P:Koenig_H:,Helv. Chim. Acta,1943,26,619}}]] | ||
}} | }} | ||
Revision as of 09:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0168 |
| LipidMaps | LMFA01030129 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF19206SC01 |
| GlcNAca/b1-3Xyla-4Galb1-3GalNAca1-4(NeuAc?1-2NeuGc4Mea1-3)GalNAcb1-4(EtnP-6)GlcNAcb1-3Manb1-4Glcb1-1Cer | |
|---|---|
| |
| Structural Information | |
| cis-10, cis-13-Nonadecadienoic acid | |
| Formula | C19H34O2 |
| Exact Mass | 294.255880332 |
| Average Mass | 294.47206000000006 |
| SMILES | CCCCCC=CCC=CCCCCCCCCC(O)=O |
| Physicochemical Information | |
| KarrerPet al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
