LBF20107PG04: Difference between revisions
m LBF20207PG06 moved to LBF20107PG04 |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA03010146 | |LipidMaps=LMFA03010146 | ||
|SysName=9,15-dioxo-11alpha-hydroxy-prost-13E-en-1-oic acid | |SysName=9,15-dioxo-11alpha-hydroxy-prost-13E-en-1-oic acid | ||
|Common Name=&&15-keto Prostaglandin | |Common Name=&&15-keto Prostaglandin E_1&& | ||
}} | }} | ||
Revision as of 15:41, 19 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR1709 |
| LipidMaps | LMFA03010146 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20107PG04 |
| 15-keto Prostaglandin E1 | |
|---|---|
| |
| Structural Information | |
| 9,15-dioxo-11α-hydroxy-prost-13E-en-1-oic acid | |
| |
| Formula | C20H32O5 |
| Exact Mass | 352.224974134 |
| Average Mass | 352.46508 |
| SMILES | C(CCC(=O)C=C[C@H]([C@H]1CCCCCCC(O)=O)[C@@H](CC1=O)O)CC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
