LBF20107PG07: Difference between revisions
No edit summary |
m LBF20207PG09 moved to LBF20107PG07 |
||
(No difference)
| |||
Revision as of 17:40, 16 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR1718 |
| LipidMaps | LMFA03010038 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20107PG07 |
| 19 (R) -hydroxy Prostaglandin F1α | |
|---|---|
| |
| Structural Information | |
| 9α,11α,15S,19R-tetrahydroxy-prost-13E-en-1-oic acid | |
| |
| Formula | C20H36O6 |
| Exact Mass | 372.251188884 |
| Average Mass | 372.49624 |
| SMILES | [C@H]([C@@H](C=C[C@H](O)CCC[C@@H](C)O)1)([C@H](C[C@H]1O)O)CCCCCCC(O)=O |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
