LBF20107PG08: Difference between revisions
m LBF20207PG11 moved to LBF20107PG08 |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA03010049 | |LipidMaps=LMFA03010049 | ||
|SysName= 9alpha,15S-dihydroxy-11-oxo-prost-13E-en-1-oic acid | |SysName= 9alpha,15S-dihydroxy-11-oxo-prost-13E-en-1-oic acid | ||
|Common Name=&&Prostaglandin | |Common Name=&&Prostaglandin D_1&& | ||
}} | }} | ||
Revision as of 15:43, 19 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR1731 |
| LipidMaps | LMFA03010049 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20107PG08 |
| Prostaglandin D1 | |
|---|---|
| |
| Structural Information | |
| 9α,15S-dihydroxy-11-oxo-prost-13E-en-1-oic acid | |
| |
| Formula | C20H32O4 |
| Exact Mass | 336.23005951199997 |
| Average Mass | 336.46567999999996 |
| SMILES | C(CC[C@H](O)C=C[C@H]([C@H]1CCCCCCC(O)=O)C=CC(=O)1)CC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
