LBF20107PG21: Difference between revisions
m LBF20307PG37 moved to LBF20107PG21 |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA03010129 | |LipidMaps=LMFA03010129 | ||
|SysName=6S,9a-epoxy-11a,15S-dihydroxy-prost-13E-en-1-oic acid | |SysName=6S,9a-epoxy-11a,15S-dihydroxy-prost-13E-en-1-oic acid | ||
|Common Name=&&6b-Prostaglandin | |Common Name=&&6b-Prostaglandin I_1&& | ||
}} | }} | ||
Revision as of 16:37, 19 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR1800 |
| LipidMaps | LMFA03010129 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20107PG21 |
| 6b-Prostaglandin I1 | |
|---|---|
| |
| Structural Information | |
| 6S,9a-epoxy-11a,15S-dihydroxy-prost-13E-en-1-oic acid | |
| |
| Formula | C20H34O5 |
| Exact Mass | 354.240624198 |
| Average Mass | 354.48096000000004 |
| SMILES | C(CC[C@H](O)C=C[C@H]([C@H]12)[C@H](O)C[C@H](O[C@H](C2)CCCCC(O)=O)1)CC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
