LBF20111SC01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01030084 | |LipidMaps=LMFA01030084 | ||
|SysName=cis-9-Eicosenoic acid | |SysName=cis-9-Eicosenoic acid | ||
|Common Name=&&cis-Gadoleic acid&&cis-9-icosenoic acid&& | |Common Name=&&cis-Gadoleic acid&&cis-9-icosenoic acid&&cis-9-Eicosenoic acid&& | ||
|Melting Point=23-23.5°C | |Melting Point=23-23.5°C | ||
|Boiling Point=170°C at 0.1 mmHg | |Boiling Point=170°C at 0.1 mmHg | ||
Revision as of 09:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0123 |
| LipidMaps | LMFA01030084 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20111SC01 |
| cis-Gadoleic acid | |
|---|---|
| |
| Structural Information | |
| cis-9-Eicosenoic acid | |
| |
| Formula | C20H38O2 |
| Exact Mass | 310.28718046 |
| Average Mass | 310.51452 |
| SMILES | C(CCCCCCC=CCCCCCCCC(O)=O)CCC |
| Physicochemical Information | |
| 23-23.5°C | |
| 170°C at 0.1 mmHg | |
| dX425 0.882 | |
| 1.4597 at 25°C | |
| soluble in acetone, methylalcohol and petroleumether Hileditch_TP et al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
