LBF20115PG04: Difference between revisions
m LBF202nnPG06 moved to LBF20115PG04 |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA03010079 | |LipidMaps=LMFA03010079 | ||
|SysName= 9alpha,11alpha,15S-trihydroxy-prost-5Z-en-1-oic acid | |SysName= 9alpha,11alpha,15S-trihydroxy-prost-5Z-en-1-oic acid | ||
|Common Name=&& 13,14-dihydro Prostaglandin | |Common Name=&& 13,14-dihydro Prostaglandin F_2alpha&& | ||
}} | }} | ||
Revision as of 16:06, 19 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR1761 |
| LipidMaps | LMFA03010079 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20115PG04 |
| 13,14-dihydro Prostaglandin F_2α | |
|---|---|
| |
| Structural Information | |
| 9α,11α,15S-trihydroxy-prost-5Z-en-1-oic acid | |
| |
| Formula | C20H36O5 |
| Exact Mass | 356.256274262 |
| Average Mass | 356.49684 |
| SMILES | C(CC[C@@H](O)CC[C@H]([C@H]1CC=CCCCC(O)=O)[C@@H](C[C@@H]1O)O)CC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
