LBF20207PG27: Difference between revisions
No edit summary |
m LBF20307PG11 moved to LBF20207PG27 |
(No difference)
| |
Revision as of 17:51, 16 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR1601 |
| LipidMaps | LMFA03010009 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20207PG27 |
| PROSTAGLANDIN G2 | |
|---|---|
| |
| Structural Information | |
| 7- [ 2 (R) - (3 (S) -Hydroperoxy-1 (E) -octenyl) -1 (R) ,4 (S) -5,6-dioxabicyclo [ 2.2.1 ] -heptan-3 (R) -yl ] -5 (Z) -heptenoic acid | |
| |
| Formula | C20H32O6 |
| Exact Mass | 368.219888756 |
| Average Mass | 368.46448 |
| SMILES | C(CC[C@@H](OO)C=C[C@@H]([C@H]21)[C@@H](CC=CCCCC(O)=O)[C@@H](OO2)C1)CC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 13C-NMR : d 84.6(C15) Porter_NA et al. |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | |||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
