LBF20207PG33: Difference between revisions
m LBF20307PG18 moved to LBF20207PG33 |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA03010029 | |LipidMaps=LMFA03010029 | ||
|SysName=9alpha,11alpha,15S,20-tetrahydroxy-prosta-5Z,13E-dien-1-oic acid | |SysName=9alpha,11alpha,15S,20-tetrahydroxy-prosta-5Z,13E-dien-1-oic acid | ||
|Common Name=&&20-hydroxy Prostaglandin | |Common Name=&&20-hydroxy Prostaglandin F_2alpha&& | ||
}} | }} | ||
Revision as of 16:31, 19 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR1723 |
| LipidMaps | LMFA03010029 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20207PG33 |
| 20-hydroxy Prostaglandin F_2α | |
|---|---|
| |
| Structural Information | |
| 9α,11α,15S,20-tetrahydroxy-prosta-5Z,13E-dien-1-oic acid | |
| |
| Formula | C20H34O6 |
| Exact Mass | 370.23553882 |
| Average Mass | 370.48036 |
| SMILES | C(CCC[C@@H](O)C=C[C@H]([C@H]1CC=CCCCC(O)=O)[C@@H](C[C@@H]1O)O)CO |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
