LBF20207TX01: Difference between revisions
m LBF20307TX01 moved to LBF20207TX01 |
m LBF20307TX01 moved to LBF20207TX01 |
(No difference)
| |
Revision as of 09:02, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR2001 |
| LipidMaps | LMFA03030001 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20207TX01 |
| THROMBOXANE A2 | |
|---|---|
| |
| Structural Information | |
| 7- [ 3- (3 (S) -Hydroxy-1 (E) -octenyl) -1 (S) ,5 (S) ,4,6-dioxabicyclo [ 3.1.1 ] hept-2-yl ] -5 (Z) -heptenoic acid | |
| |
| Formula | C20H32O5 |
| Exact Mass | 352.224974134 |
| Average Mass | 352.46508 |
| SMILES | C(CC[C@@H](O)C=C[C@H]([C@@H](CC=CCCCC(O)=O)1)O[C@H](C2)O[C@@H]12)CC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | |||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
