LBF20306HX03: Difference between revisions
m LBF20406HX01 moved to LBF20306HX03 |
m LBF20406HX01 moved to LBF20306HX03 |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA03090005 | |LipidMaps=LMFA03090005 | ||
|SysName=8-Hydroxy-11,12 (S,S) -epoxyeicosa-5,14 (Z,Z) ,9 (E) -trienoic acid | |SysName=8-Hydroxy-11,12 (S,S) -epoxyeicosa-5,14 (Z,Z) ,9 (E) -trienoic acid | ||
|Common Name=&&HEPOXILIN A3&& | |Common Name=&&HEPOXILIN A3&&8-Hydroxy-11,12 (S,S) -epoxyeicosa-5,14 (Z,Z) ,9 (E) -trienoic acid&& | ||
|Solubility=DIETHYL ETHER [[Reference:Pace-Asciak_CR:Mizuno_K:Yamamoto_S:,Prostaglandins,1983,25,79|{{RelationTable/GetFirstAuthor|Reference:Pace-Asciak_CR:Mizuno_K:Yamamoto_S:,Prostaglandins,1983,25,79}}]] | |Solubility=DIETHYL ETHER [[Reference:Pace-Asciak_CR:Mizuno_K:Yamamoto_S:,Prostaglandins,1983,25,79|{{RelationTable/GetFirstAuthor|Reference:Pace-Asciak_CR:Mizuno_K:Yamamoto_S:,Prostaglandins,1983,25,79}}]] | ||
|Mass Spectra=METHYL ESTER TRIS-TMS ETHER ; m/e 422(M<SUP><FONT SIZE=-1>+</FONT></SUP>), 407, 391, 332, 311, 282, 269(base peak) [[Reference:Walker_IC:Jones_RL:Wilson_NH:,Prostaglandins,1979,18,173|{{RelationTable/GetFirstAuthor|Reference:Walker_IC:Jones_RL:Wilson_NH:,Prostaglandins,1979,18,173}}]] | |Mass Spectra=METHYL ESTER TRIS-TMS ETHER ; m/e 422(M<SUP><FONT SIZE=-1>+</FONT></SUP>), 407, 391, 332, 311, 282, 269(base peak) [[Reference:Walker_IC:Jones_RL:Wilson_NH:,Prostaglandins,1979,18,173|{{RelationTable/GetFirstAuthor|Reference:Walker_IC:Jones_RL:Wilson_NH:,Prostaglandins,1979,18,173}}]] | ||
}} | }} | ||
Revision as of 09:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR5001 |
| LipidMaps | LMFA03090005 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20306HX03 |
| HEPOXILIN A3 | |
|---|---|
| |
| Structural Information | |
| 8-Hydroxy-11,12 (S,S) -epoxyeicosa-5,14 (Z,Z) ,9 (E) -trienoic acid | |
| |
| Formula | C20H32O4 |
| Exact Mass | 336.23005951199997 |
| Average Mass | 336.46567999999996 |
| SMILES | C(=C[C@@H](O)CC=CCCCC(O)=O)[C@@H](O1)[C@@H]1CC=CCCCCC |
| Physicochemical Information | |
| DIETHYL ETHER Pace-Asciak_CR et al. | |
| Spectral Information | |
| Mass Spectra | METHYL ESTER TRIS-TMS ETHER ; m/e 422(M+), 407, 391, 332, 311, 282, 269(base peak) Walker_IC et al. |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
